C12H14N4O — CID 125011496
5-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-1,3-oxazole (PubChem CID 125011496) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-1,3-oxazole.
| Compound Name | 5-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 125011496 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 5-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-1,3-oxazole |
| SMILES | c1cnc(N2CCC[C@@H](c3cnco3)C2)cn1 |
| InChI | InChI=1S/C12H14N4O/c1-2-10(11-6-14-9-17-11)8-16(5-1)12-7-13-3-4-15-12/h3-4,6-7,9-10H,1-2,5,8H2/t10-/m1/s1 |
| InChIKey | VQKRAZMNFRGTPL-SNVBAGLBSA-N |
| XLogP | 1.85 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |