C15H17ClN4O3 — CID 121160458
N-(4-chlorophenyl)-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide (PubChem CID 121160458) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121160458 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(4-chlorophenyl)-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CCC(N2C(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C15H17ClN4O3/c16-10-1-3-11(4-2-10)18-15(23)19-7-5-12(6-8-19)20-13(21)9-17-14(20)22/h1-4,12H,5-9H2,(H,17,22)(H,18,23) |
| InChIKey | VJYSSNOAANXPJK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|