C16H18ClFN4O5S — CID 121160283
3-chloro-N-[2-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide (PubChem CID 121160283) has the molecular formula C16H18ClFN4O5S and a molecular weight of 432.86 g/mol. Its IUPAC name is 3-chloro-N-[2-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 121160283 |
| Molecular Formula | C16H18ClFN4O5S |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 3-chloro-N-[2-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)c(Cl)c1)N1CCC(N2C(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C16H18ClFN4O5S/c17-12-7-11(1-2-13(12)18)28(26,27)20-9-14(23)21-5-3-10(4-6-21)22-15(24)8-19-16(22)25/h1-2,7,10,20H,3-6,8-9H2,(H,19,25) |
| InChIKey | FGVIEHZUYSNQCV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|