C14H17Cl2N3O4S — CID 112991971
N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3,4-dichlorobenzenesulfonamide (PubChem CID 112991971) has the molecular formula C14H17Cl2N3O4S and a molecular weight of 394.28 g/mol. Its IUPAC name is N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 112991971 |
| Molecular Formula | C14H17Cl2N3O4S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3,4-dichlorobenzenesulfonamide |
| SMILES | CC(=O)N1CCN(C(=O)CNS(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O4S/c1-10(20)18-4-6-19(7-5-18)14(21)9-17-24(22,23)11-2-3-12(15)13(16)8-11/h2-3,8,17H,4-7,9H2,1H3 |
| InChIKey | XOOSFJVJLKYWJY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |