C11H14ClN3O3S — CID 113405985
2-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-sulfonamide (PubChem CID 113405985) has the molecular formula C11H14ClN3O3S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 113405985 |
| Molecular Formula | C11H14ClN3O3S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-sulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccnc(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C11H14ClN3O3S/c12-10-7-9(3-4-13-10)19(17,18)14-8-11(16)15-5-1-2-6-15/h3-4,7,14H,1-2,5-6,8H2 |
| InChIKey | YWSKVGKXFJJZGE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|