C8H9ClN2O4S — CID 61249244
3-[(2-chloro-4-pyridinyl)sulfonylamino]propanoic acid (PubChem CID 61249244) has the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(2-chloro-4-pyridinyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 61249244 |
| Molecular Formula | C8H9ClN2O4S |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C8H9ClN2O4S/c9-7-5-6(1-3-10-7)16(14,15)11-4-2-8(12)13/h1,3,5,11H,2,4H2,(H,12,13) |
| InChIKey | GVYCSJROLHVDKS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|