C11H10Cl2N2O2S2 — CID 114139001
2-chloro-N-[2-(5-chlorothiophen-2-yl)ethyl]pyridine-4-sulfonamide (PubChem CID 114139001) has the molecular formula C11H10Cl2N2O2S2 and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-chloro-N-[2-(5-chlorothiophen-2-yl)ethyl]pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-[2-(5-chlorothiophen-2-yl)ethyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 114139001 |
| Molecular Formula | C11H10Cl2N2O2S2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2-chloro-N-[2-(5-chlorothiophen-2-yl)ethyl]pyridine-4-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(Cl)s1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N2O2S2/c12-10-7-9(4-5-14-10)19(16,17)15-6-3-8-1-2-11(13)18-8/h1-2,4-5,7,15H,3,6H2 |
| InChIKey | XNVKTOWAQPEVPG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|