C10H10ClN3O4S2 — CID 61216557
2-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyridine-4-sulfonamide (PubChem CID 61216557) has the molecular formula C10H10ClN3O4S2 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61216557 |
| Molecular Formula | C10H10ClN3O4S2 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyridine-4-sulfonamide |
| SMILES | O=C1CSC(=O)N1CCNS(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H10ClN3O4S2/c11-8-5-7(1-2-12-8)20(17,18)13-3-4-14-9(15)6-19-10(14)16/h1-2,5,13H,3-4,6H2 |
| InChIKey | CNXZTRLLNYPTCX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|