C12H19ClN2O3S — CID 61247710
2-chloro-N-[3-(2-methylpropoxy)propyl]pyridine-4-sulfonamide (PubChem CID 61247710) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is 2-chloro-N-[3-(2-methylpropoxy)propyl]pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-[3-(2-methylpropoxy)propyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61247710 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-chloro-N-[3-(2-methylpropoxy)propyl]pyridine-4-sulfonamide |
| SMILES | CC(C)COCCCNS(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2O3S/c1-10(2)9-18-7-3-5-15-19(16,17)11-4-6-14-12(13)8-11/h4,6,8,10,15H,3,5,7,9H2,1-2H3 |
| InChIKey | GZLBSEQWWWERAI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|