C22H24N4O3 — CID 121160469
N-benzhydryl-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide (PubChem CID 121160469) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-benzhydryl-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide.
| Compound Name | N-benzhydryl-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121160469 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-benzhydryl-4-(2,5-dioxoimidazolidin-1-yl)piperidine-1-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)N1CCC(N2C(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C22H24N4O3/c27-19-15-23-21(28)26(19)18-11-13-25(14-12-18)22(29)24-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18,20H,11-15H2,(H,23,28)(H,24,29) |
| InChIKey | MTVLMACXAKCOCD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|