C12H23N3O — CID 125041151
1-[(3R)-piperidin-3-yl]-3-propan-2-yl-1,3-diazinan-2-one (PubChem CID 125041151) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-[(3R)-piperidin-3-yl]-3-propan-2-yl-1,3-diazinan-2-one.
| Compound Name | 1-[(3R)-piperidin-3-yl]-3-propan-2-yl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 125041151 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-[(3R)-piperidin-3-yl]-3-propan-2-yl-1,3-diazinan-2-one |
| SMILES | CC(C)N1CCCN([C@@H]2CCCNC2)C1=O |
| InChI | InChI=1S/C12H23N3O/c1-10(2)14-7-4-8-15(12(14)16)11-5-3-6-13-9-11/h10-11,13H,3-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | DASDTWPLCYZOSL-LLVKDONJSA-N |
| XLogP | 1.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |