About 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane
1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane (PubChem CID 157428700) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane.
Molecular Properties
| Compound Name | 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane |
| PubChem CID | 157428700 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane |
| SMILES | CC.CC(C)N1CCCN(C(C)C)C1=O |
| InChI | InChI=1S/C10H20N2O.C2H6/c1-8(2)11-6-5-7-12(9(3)4)10(11)13;1-2/h8-9H,5-7H2,1-4H3;1-2H3 |
| InChIKey | BQGRWWZAAOTXOT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane?
The IUPAC name of 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane (CID 157428700) is 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane.
What is the SMILES notation for 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane?
The canonical SMILES for 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane is CC.CC(C)N1CCCN(C(C)C)C1=O.
What is the InChIKey of 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane?
The InChIKey is BQGRWWZAAOTXOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.C2H6/c1-8(2)11-6-5-7-12(9(3)4)10(11)13;1-2/h8-9H,5-7H2,1-4H3;1-2H3.
What are the key properties of 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane?
1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane has a molecular weight of 214.35 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(propan-2-yl)-1,3-diazinan-2-one;ethane is sourced from PubChem (CID 157428700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).