C8H13NO — CID 11051727
(8aR)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 11051727) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (8aR)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (8aR)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 11051727 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (8aR)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | O=C1CCC[C@@H]2CCCN12 |
| InChI | InChI=1S/C8H13NO/c10-8-5-1-3-7-4-2-6-9(7)8/h7H,1-6H2/t7-/m1/s1 |
| InChIKey | RDPDXQHZOLPNMZ-SSDOTTSWSA-N |
| XLogP | 1.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |