C11H20N2O — CID 117015321
4-cyclopentyl-1,4-diazocan-5-one (PubChem CID 117015321) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-cyclopentyl-1,4-diazocan-5-one.
| Compound Name | 4-cyclopentyl-1,4-diazocan-5-one |
|---|---|
| PubChem CID | 117015321 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 4-cyclopentyl-1,4-diazocan-5-one |
| SMILES | O=C1CCCNCCN1C1CCCC1 |
| InChI | InChI=1S/C11H20N2O/c14-11-6-3-7-12-8-9-13(11)10-4-1-2-5-10/h10,12H,1-9H2 |
| InChIKey | XZTAXNIDRYLJMD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |