C7H14N2O — CID 117015312
4-methyl-1,4-diazocan-5-one (PubChem CID 117015312) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-methyl-1,4-diazocan-5-one.
| Compound Name | 4-methyl-1,4-diazocan-5-one |
|---|---|
| PubChem CID | 117015312 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 4-methyl-1,4-diazocan-5-one |
| SMILES | CN1CCNCCCC1=O |
| InChI | InChI=1S/C7H14N2O/c1-9-6-5-8-4-2-3-7(9)10/h8H,2-6H2,1H3 |
| InChIKey | BYVSADHYHRRZGR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |