C14H18N2O3S — CID 105357295
8-ethoxy-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one (PubChem CID 105357295) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 8-ethoxy-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one.
| Compound Name | 8-ethoxy-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 105357295 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 8-ethoxy-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
| SMILES | CCOc1cccc2c1NC(=O)CC1CS(=O)CCN21 |
| InChI | InChI=1S/C14H18N2O3S/c1-2-19-12-5-3-4-11-14(12)15-13(17)8-10-9-20(18)7-6-16(10)11/h3-5,10H,2,6-9H2,1H3,(H,15,17) |
| InChIKey | OUSWNPQYXAUZCW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |