C11H14O3 — CID 70446962
8-methoxy-2,2-dimethyl-4H-1,3-benzodioxine (PubChem CID 70446962) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 8-methoxy-2,2-dimethyl-4H-1,3-benzodioxine.
| Compound Name | 8-methoxy-2,2-dimethyl-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 70446962 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 8-methoxy-2,2-dimethyl-4H-1,3-benzodioxine |
| SMILES | COc1cccc2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C11H14O3/c1-11(2)13-7-8-5-4-6-9(12-3)10(8)14-11/h4-6H,7H2,1-3H3 |
| InChIKey | ZWMMJILVYKRMBB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |