C11H13NO2S — CID 163542578
N-[(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)methylidene]thiohydroxylamine (PubChem CID 163542578) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is N-[(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)methylidene]thiohydroxylamine.
| Compound Name | N-[(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)methylidene]thiohydroxylamine |
|---|---|
| PubChem CID | 163542578 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | N-[(2,2-dimethyl-4H-1,3-benzodioxin-8-yl)methylidene]thiohydroxylamine |
| SMILES | CC1(C)OCc2cccc(C=NS)c2O1 |
| InChI | InChI=1S/C11H13NO2S/c1-11(2)13-7-9-5-3-4-8(6-12-15)10(9)14-11/h3-6,15H,7H2,1-2H3 |
| InChIKey | FCIUICUQGNHKFO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|