C20H26O5 — CID 162624700
5-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-2,2-dimethyl-4H-1,3-benzodioxine (PubChem CID 162624700) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 5-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-2,2-dimethyl-4H-1,3-benzodioxine.
| Compound Name | 5-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-2,2-dimethyl-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 162624700 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 5-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]-2,2-dimethyl-4H-1,3-benzodioxine |
| SMILES | C[C@@H]1O[C@H](/C=C/c2cccc3c2COC(C)(C)O3)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H26O5/c1-12-17-18(25-20(4,5)24-17)16(22-12)10-9-13-7-6-8-15-14(13)11-21-19(2,3)23-15/h6-10,12,16-18H,11H2,1-5H3/b10-9+/t12-,16+,17-,18+/m0/s1 |
| InChIKey | ASZHVJJUYASEPA-RHFODVILSA-N |
| XLogP | 3.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |