C17H22O4 — CID 102453994
[2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]phenyl]methanol (PubChem CID 102453994) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]phenyl]methanol.
| Compound Name | [2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 102453994 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [2-[(E)-2-[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethenyl]phenyl]methanol |
| SMILES | C[C@@H]1O[C@H](/C=C/c2ccccc2CO)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H22O4/c1-11-15-16(21-17(2,3)20-15)14(19-11)9-8-12-6-4-5-7-13(12)10-18/h4-9,11,14-16,18H,10H2,1-3H3/b9-8+/t11-,14+,15-,16+/m0/s1 |
| InChIKey | BQROHVRPTGIMBD-LMERGRNLSA-N |
| XLogP | 2.50 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |