C12H17NO2 — CID 84722416
(8-methoxy-3-methyl-2,4-dihydrochromen-3-yl)methanamine (PubChem CID 84722416) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (8-methoxy-3-methyl-2,4-dihydrochromen-3-yl)methanamine.
| Compound Name | (8-methoxy-3-methyl-2,4-dihydrochromen-3-yl)methanamine |
|---|---|
| PubChem CID | 84722416 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (8-methoxy-3-methyl-2,4-dihydrochromen-3-yl)methanamine |
| SMILES | COc1cccc2c1OCC(C)(CN)C2 |
| InChI | InChI=1S/C12H17NO2/c1-12(7-13)6-9-4-3-5-10(14-2)11(9)15-8-12/h3-5H,6-8,13H2,1-2H3 |
| InChIKey | RAMXZHOGPHRLIU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |