C12H16O2 — CID 63822286
5-methoxy-3-methyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 63822286) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-methoxy-3-methyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 5-methoxy-3-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 63822286 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5-methoxy-3-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | COc1cccc2c1CC(C)CC2O |
| InChI | InChI=1S/C12H16O2/c1-8-6-10-9(11(13)7-8)4-3-5-12(10)14-2/h3-5,8,11,13H,6-7H2,1-2H3 |
| InChIKey | VNKPGBOTEXHLKJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |