C11H14O4 — CID 139587454
(1S,2S,4R)-8-methoxy-1,2,3,4-tetrahydronaphthalene-1,2,4-triol (PubChem CID 139587454) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1S,2S,4R)-8-methoxy-1,2,3,4-tetrahydronaphthalene-1,2,4-triol.
| Compound Name | (1S,2S,4R)-8-methoxy-1,2,3,4-tetrahydronaphthalene-1,2,4-triol |
|---|---|
| PubChem CID | 139587454 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1S,2S,4R)-8-methoxy-1,2,3,4-tetrahydronaphthalene-1,2,4-triol |
| SMILES | COc1cccc2c1[C@H](O)[C@@H](O)C[C@H]2O |
| InChI | InChI=1S/C11H14O4/c1-15-9-4-2-3-6-7(12)5-8(13)11(14)10(6)9/h2-4,7-8,11-14H,5H2,1H3/t7-,8+,11-/m1/s1 |
| InChIKey | UKFNTIAARGWWOP-VHSKPIJISA-N |
| XLogP | 0.53 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |