C11H12O3 — CID 11344527
(1R,2S)-8-methoxy-1,2-dihydronaphthalene-1,2-diol (PubChem CID 11344527) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (1R,2S)-8-methoxy-1,2-dihydronaphthalene-1,2-diol.
| Compound Name | (1R,2S)-8-methoxy-1,2-dihydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 11344527 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (1R,2S)-8-methoxy-1,2-dihydronaphthalene-1,2-diol |
| SMILES | COc1cccc2c1[C@@H](O)[C@@H](O)C=C2 |
| InChI | InChI=1S/C11H12O3/c1-14-9-4-2-3-7-5-6-8(12)11(13)10(7)9/h2-6,8,11-13H,1H3/t8-,11-/m0/s1 |
| InChIKey | SFEPTPGKKJVLFU-KWQFWETISA-N |
| XLogP | 1.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |