C13H14O3 — CID 11053126
(1S,2R)-3-(2-methoxyphenyl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 11053126) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1S,2R)-3-(2-methoxyphenyl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-(2-methoxyphenyl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 11053126 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1S,2R)-3-(2-methoxyphenyl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | COc1ccccc1C1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H14O3/c1-16-12-8-3-2-5-9(12)10-6-4-7-11(14)13(10)15/h2-8,11,13-15H,1H3/t11-,13+/m0/s1 |
| InChIKey | WUCMTJSSBPUJHJ-WCQYABFASA-N |
| XLogP | 1.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |