C22H17NO4 — CID 132524676
4-[[(1S,2R)-1-hydroxy-8-methoxy-1,2-dihydronaphthalen-2-yl]methyl]-2-oxochromene-3-carbonitrile (PubChem CID 132524676) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-[[(1S,2R)-1-hydroxy-8-methoxy-1,2-dihydronaphthalen-2-yl]methyl]-2-oxochromene-3-carbonitrile.
| Compound Name | 4-[[(1S,2R)-1-hydroxy-8-methoxy-1,2-dihydronaphthalen-2-yl]methyl]-2-oxochromene-3-carbonitrile |
|---|---|
| PubChem CID | 132524676 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-[[(1S,2R)-1-hydroxy-8-methoxy-1,2-dihydronaphthalen-2-yl]methyl]-2-oxochromene-3-carbonitrile |
| SMILES | COc1cccc2c1[C@@H](O)[C@H](Cc1c(C#N)c(=O)oc3ccccc13)C=C2 |
| InChI | InChI=1S/C22H17NO4/c1-26-19-8-4-5-13-9-10-14(21(24)20(13)19)11-16-15-6-2-3-7-18(15)27-22(25)17(16)12-23/h2-10,14,21,24H,11H2,1H3/t14-,21-/m0/s1 |
| InChIKey | HVVCFKZMJJQJSX-QKKBWIMNSA-N |
| XLogP | 3.59 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|