C22H18N2O6 — CID 56694097
2-amino-5-oxo-4-(2,4,6-trimethoxyphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 56694097) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-amino-5-oxo-4-(2,4,6-trimethoxyphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-5-oxo-4-(2,4,6-trimethoxyphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 56694097 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-amino-5-oxo-4-(2,4,6-trimethoxyphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | COc1cc(OC)c(C2C(C#N)=C(N)Oc3c2c(=O)oc2ccccc32)c(OC)c1 |
| InChI | InChI=1S/C22H18N2O6/c1-26-11-8-15(27-2)18(16(9-11)28-3)17-13(10-23)21(24)30-20-12-6-4-5-7-14(12)29-22(25)19(17)20/h4-9,17H,24H2,1-3H3 |
| InChIKey | ADBUTFJRJMYWCG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|