C27H20N2O5 — CID 4042475
2-amino-4-(4-methoxy-3-phenylmethoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 4042475) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-amino-4-(4-methoxy-3-phenylmethoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(4-methoxy-3-phenylmethoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 4042475 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-amino-4-(4-methoxy-3-phenylmethoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3c2c(=O)oc2ccccc32)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H20N2O5/c1-31-21-12-11-17(13-22(21)32-15-16-7-3-2-4-8-16)23-19(14-28)26(29)34-25-18-9-5-6-10-20(18)33-27(30)24(23)25/h2-13,23H,15,29H2,1H3 |
| InChIKey | IJQGEGFQAHDCQN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|