C14H10N2O3 — CID 2855827
2-amino-4-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 2855827) has the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-amino-4-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2855827 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-amino-4-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | CC1C(C#N)=C(N)Oc2c1c(=O)oc1ccccc21 |
| InChI | InChI=1S/C14H10N2O3/c1-7-9(6-15)13(16)19-12-8-4-2-3-5-10(8)18-14(17)11(7)12/h2-5,7H,16H2,1H3 |
| InChIKey | HISMJRIIQSDFJO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|