C17H16N2O3 — CID 6934996
(4S)-2-amino-4-[(2R)-butan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 6934996) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (4S)-2-amino-4-[(2R)-butan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-[(2R)-butan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 6934996 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (4S)-2-amino-4-[(2R)-butan-2-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | CC[C@@H](C)[C@H]1C(C#N)=C(N)Oc2c1c(=O)oc1ccccc21 |
| InChI | InChI=1S/C17H16N2O3/c1-3-9(2)13-11(8-18)16(19)22-15-10-6-4-5-7-12(10)21-17(20)14(13)15/h4-7,9,13H,3,19H2,1-2H3/t9-,13+/m1/s1 |
| InChIKey | PISQAJRNAMSGQT-RNCFNFMXSA-N |
| XLogP | 3.01 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|