C18H11N3O3 — CID 673966
(4R)-2-amino-5-oxo-4-pyridin-4-yl-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 673966) has the molecular formula C18H11N3O3 and a molecular weight of 317.30 g/mol. Its IUPAC name is (4R)-2-amino-5-oxo-4-pyridin-4-yl-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-5-oxo-4-pyridin-4-yl-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 673966 |
| Molecular Formula | C18H11N3O3 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (4R)-2-amino-5-oxo-4-pyridin-4-yl-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C18H11N3O3/c19-9-12-14(10-5-7-21-8-6-10)15-16(24-17(12)20)11-3-1-2-4-13(11)23-18(15)22/h1-8,14H,20H2/t14-/m1/s1 |
| InChIKey | YSEIMMXFCQXESG-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|