C21H10F6N2O3 — CID 171662596
2-amino-4-[3,5-bis(trifluoromethyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 171662596) has the molecular formula C21H10F6N2O3 and a molecular weight of 452.31 g/mol. Its IUPAC name is 2-amino-4-[3,5-bis(trifluoromethyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-[3,5-bis(trifluoromethyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 171662596 |
| Molecular Formula | C21H10F6N2O3 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-amino-4-[3,5-bis(trifluoromethyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)C1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H10F6N2O3/c22-20(23,24)10-5-9(6-11(7-10)21(25,26)27)15-13(8-28)18(29)32-17-12-3-1-2-4-14(12)31-19(30)16(15)17/h1-7,15H,29H2 |
| InChIKey | PVBYBISZBQUPOJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|