C22H14N4O3 — CID 142491826
2-amino-5-oxo-4-[4-(1H-pyrazol-4-yl)phenyl]-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 142491826) has the molecular formula C22H14N4O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-amino-5-oxo-4-[4-(1H-pyrazol-4-yl)phenyl]-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-5-oxo-4-[4-(1H-pyrazol-4-yl)phenyl]-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 142491826 |
| Molecular Formula | C22H14N4O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-amino-5-oxo-4-[4-(1H-pyrazol-4-yl)phenyl]-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)C1c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C22H14N4O3/c23-9-16-18(13-7-5-12(6-8-13)14-10-25-26-11-14)19-20(29-21(16)24)15-3-1-2-4-17(15)28-22(19)27/h1-8,10-11,18H,24H2,(H,25,26) |
| InChIKey | UFCAMRHSKDAVIR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|