C18H18O3 — CID 132579460
(1S,2S)-6,7-dimethoxy-2-phenyl-1,2-dihydronaphthalen-1-ol (PubChem CID 132579460) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1S,2S)-6,7-dimethoxy-2-phenyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2S)-6,7-dimethoxy-2-phenyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 132579460 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (1S,2S)-6,7-dimethoxy-2-phenyl-1,2-dihydronaphthalen-1-ol |
| SMILES | COc1cc2c(cc1OC)[C@@H](O)[C@H](c1ccccc1)C=C2 |
| InChI | InChI=1S/C18H18O3/c1-20-16-10-13-8-9-14(12-6-4-3-5-7-12)18(19)15(13)11-17(16)21-2/h3-11,14,18-19H,1-2H3/t14-,18-/m0/s1 |
| InChIKey | ZJKQOYYBTKXEFW-KSSFIOAISA-N |
| XLogP | 3.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |