C23H22O4 — CID 132544355
(3R,4S)-7-methoxy-4-phenyl-6-phenylmethoxy-3,4-dihydro-2H-chromen-3-ol (PubChem CID 132544355) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3R,4S)-7-methoxy-4-phenyl-6-phenylmethoxy-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | (3R,4S)-7-methoxy-4-phenyl-6-phenylmethoxy-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 132544355 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (3R,4S)-7-methoxy-4-phenyl-6-phenylmethoxy-3,4-dihydro-2H-chromen-3-ol |
| SMILES | COc1cc2c(cc1OCc1ccccc1)[C@H](c1ccccc1)[C@@H](O)CO2 |
| InChI | InChI=1S/C23H22O4/c1-25-21-13-20-18(12-22(21)26-14-16-8-4-2-5-9-16)23(19(24)15-27-20)17-10-6-3-7-11-17/h2-13,19,23-24H,14-15H2,1H3/t19-,23-/m0/s1 |
| InChIKey | OUMIXWIRSAJODX-CVDCTZTESA-N |
| XLogP | 4.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |