C20H22O4 — CID 156760249
6-methoxy-7-phenylmethoxy-2-propan-2-yl-2,3-dihydrochromen-4-one (PubChem CID 156760249) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 6-methoxy-7-phenylmethoxy-2-propan-2-yl-2,3-dihydrochromen-4-one.
| Compound Name | 6-methoxy-7-phenylmethoxy-2-propan-2-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 156760249 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 6-methoxy-7-phenylmethoxy-2-propan-2-yl-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(cc1OCc1ccccc1)OC(C(C)C)CC2=O |
| InChI | InChI=1S/C20H22O4/c1-13(2)17-10-16(21)15-9-19(22-3)20(11-18(15)24-17)23-12-14-7-5-4-6-8-14/h4-9,11,13,17H,10,12H2,1-3H3 |
| InChIKey | IQFAVPVOERKOCT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |