C27H22O6 — CID 171342927
6-methoxy-7-phenylmethoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene-14,21-dione (PubChem CID 171342927) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is 6-methoxy-7-phenylmethoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene-14,21-dione.
| Compound Name | 6-methoxy-7-phenylmethoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene-14,21-dione |
|---|---|
| PubChem CID | 171342927 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 6-methoxy-7-phenylmethoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene-14,21-dione |
| SMILES | COc1cc2c(cc1OCc1ccccc1)C1COC3C(=O)c4ccccc4C(=O)C3C1O2 |
| InChI | InChI=1S/C27H22O6/c1-30-21-12-20-18(11-22(21)31-13-15-7-3-2-4-8-15)19-14-32-27-23(26(19)33-20)24(28)16-9-5-6-10-17(16)25(27)29/h2-12,19,23,26-27H,13-14H2,1H3 |
| InChIKey | JTBAMGFTLMVFMD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|