C19H22O6S — CID 90748209
[(2R)-6-methoxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl] ethanesulfonate (PubChem CID 90748209) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is [(2R)-6-methoxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl] ethanesulfonate.
| Compound Name | [(2R)-6-methoxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl] ethanesulfonate |
|---|---|
| PubChem CID | 90748209 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [(2R)-6-methoxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl] ethanesulfonate |
| SMILES | CCS(=O)(=O)O[C@@H]1CCc2cc(OC)c(OCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C19H22O6S/c1-3-26(20,21)25-19-10-9-15-11-17(22-2)18(12-16(15)24-19)23-13-14-7-5-4-6-8-14/h4-8,11-12,19H,3,9-10,13H2,1-2H3/t19-/m1/s1 |
| InChIKey | WOJJPQHQGWVENI-LJQANCHMSA-N |
| XLogP | 3.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|