C25H24O5 — CID 139637319
ethyl 5,6-bis(phenylmethoxy)-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 139637319) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is ethyl 5,6-bis(phenylmethoxy)-2,3-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5,6-bis(phenylmethoxy)-2,3-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 139637319 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | ethyl 5,6-bis(phenylmethoxy)-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)C1Cc2cc(OCc3ccccc3)c(OCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C25H24O5/c1-2-27-25(26)24-14-20-13-22(28-16-18-9-5-3-6-10-18)23(15-21(20)30-24)29-17-19-11-7-4-8-12-19/h3-13,15,24H,2,14,16-17H2,1H3 |
| InChIKey | CGIVXZKBEFDTOX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |