C13H15BrO3 — CID 14796812
ethyl 5-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 14796812) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is ethyl 5-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 14796812 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | ethyl 5-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)C1Cc2cc(CCBr)ccc2O1 |
| InChI | InChI=1S/C13H15BrO3/c1-2-16-13(15)12-8-10-7-9(5-6-14)3-4-11(10)17-12/h3-4,7,12H,2,5-6,8H2,1H3 |
| InChIKey | NQMGJSGJLZTGTH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|