methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate

C11H11BrO3 — CID 88990215

IUPACmethyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate
SMILESCOC(=O)C1Cc2cc(CBr)ccc2O1
InChIInChI=1S/C11H11BrO3/c1-14-11(13)10-5-8-4-7(6-12)2-3-9(8)15-10/h2-4,10H,5-6H2,1H3
InChIKeyWDXQNIMRUHKGGP-UHFFFAOYSA-N
MW271.11 g/mol
LogP2.06
Rot. Bonds2

About methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate

methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 88990215) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate
PubChem CID88990215
Molecular FormulaC11H11BrO3
Molecular Weight271.11 g/mol
Exact Mass269.99
IUPAC Namemethyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate
SMILESCOC(=O)C1Cc2cc(CBr)ccc2O1
InChIInChI=1S/C11H11BrO3/c1-14-11(13)10-5-8-4-7(6-12)2-3-9(8)15-10/h2-4,10H,5-6H2,1H3
InChIKeyWDXQNIMRUHKGGP-UHFFFAOYSA-N
XLogP2.06
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.11
LogP ≤ 52.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate?
The IUPAC name of methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate (CID 88990215) is methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate.
What is the SMILES notation for methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate?
The canonical SMILES for methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate is COC(=O)C1Cc2cc(CBr)ccc2O1.
What is the InChIKey of methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate?
The InChIKey is WDXQNIMRUHKGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3/c1-14-11(13)10-5-8-4-7(6-12)2-3-9(8)15-10/h2-4,10H,5-6H2,1H3.
What are the key properties of methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate?
methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate has a molecular weight of 271.11 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(bromomethyl)-2,3-dihydro-1-benzofuran-2-carboxylate is sourced from PubChem (CID 88990215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).