C16H14BrNO2 — CID 114307272
N-[3-(bromomethyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 114307272) has the molecular formula C16H14BrNO2 and a molecular weight of 332.20 g/mol. Its IUPAC name is N-[3-(bromomethyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(bromomethyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 114307272 |
| Molecular Formula | C16H14BrNO2 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-[3-(bromomethyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc(CBr)c1)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H14BrNO2/c17-10-11-4-3-6-13(8-11)18-16(19)15-9-12-5-1-2-7-14(12)20-15/h1-8,15H,9-10H2,(H,18,19) |
| InChIKey | GPYYWPWMYKQJQE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|