C16H12N2O2 — CID 9083240
(2S)-N-(3-cyanophenyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 9083240) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2S)-N-(3-cyanophenyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2S)-N-(3-cyanophenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9083240 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (2S)-N-(3-cyanophenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)[C@@H]2Cc3ccccc3O2)c1 |
| InChI | InChI=1S/C16H12N2O2/c17-10-11-4-3-6-13(8-11)18-16(19)15-9-12-5-1-2-7-14(12)20-15/h1-8,15H,9H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | JPCJEMMMYXJMSX-HNNXBMFYSA-N |
| XLogP | 2.50 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |