C15H13NO3 — CID 43208767
N-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 43208767) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 43208767 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H13NO3/c17-12-7-5-11(6-8-12)16-15(18)14-9-10-3-1-2-4-13(10)19-14/h1-8,14,17H,9H2,(H,16,18) |
| InChIKey | ZSXZPQYSVTXQCV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|