C21H17NO3 — CID 9074346
(2R)-N-(4-phenoxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 9074346) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is (2R)-N-(4-phenoxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-N-(4-phenoxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9074346 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2R)-N-(4-phenoxyphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)[C@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C21H17NO3/c23-21(20-14-15-6-4-5-9-19(15)25-20)22-16-10-12-18(13-11-16)24-17-7-2-1-3-8-17/h1-13,20H,14H2,(H,22,23)/t20-/m1/s1 |
| InChIKey | QLPDRERINSIXPU-HXUWFJFHSA-N |
| XLogP | 4.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |