C22H17NO4 — CID 43024623
1-oxo-N-(4-phenoxyphenyl)-3,4-dihydroisochromene-3-carboxamide (PubChem CID 43024623) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-oxo-N-(4-phenoxyphenyl)-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | 1-oxo-N-(4-phenoxyphenyl)-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 43024623 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-oxo-N-(4-phenoxyphenyl)-3,4-dihydroisochromene-3-carboxamide |
| SMILES | O=C1OC(C(=O)Nc2ccc(Oc3ccccc3)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C22H17NO4/c24-21(20-14-15-6-4-5-9-19(15)22(25)27-20)23-16-10-12-18(13-11-16)26-17-7-2-1-3-8-17/h1-13,20H,14H2,(H,23,24) |
| InChIKey | UPTSSBNLKWOSRY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |