C16H12INO3 — CID 7589400
(3S)-N-(3-iodophenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 7589400) has the molecular formula C16H12INO3 and a molecular weight of 393.18 g/mol. Its IUPAC name is (3S)-N-(3-iodophenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | (3S)-N-(3-iodophenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 7589400 |
| Molecular Formula | C16H12INO3 |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | (3S)-N-(3-iodophenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | O=C1O[C@H](C(=O)Nc2cccc(I)c2)Cc2ccccc21 |
| InChI | InChI=1S/C16H12INO3/c17-11-5-3-6-12(9-11)18-15(19)14-8-10-4-1-2-7-13(10)16(20)21-14/h1-7,9,14H,8H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | XWJYHYVSHKERNI-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|