C18H14NO5- — CID 7389724
2-[4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl]acetate (PubChem CID 7389724) has the molecular formula C18H14NO5- and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-[4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl]acetate.
| Compound Name | 2-[4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 7389724 |
| Molecular Formula | C18H14NO5- |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl]acetate |
| SMILES | O=C([O-])Cc1ccc(NC(=O)[C@@H]2Cc3ccccc3C(=O)O2)cc1 |
| InChI | InChI=1S/C18H15NO5/c20-16(21)9-11-5-7-13(8-6-11)19-17(22)15-10-12-3-1-2-4-14(12)18(23)24-15/h1-8,15H,9-10H2,(H,19,22)(H,20,21)/p-1/t15-/m0/s1 |
| InChIKey | WDMCPYVYRCXGAA-HNNXBMFYSA-M |
| XLogP | 0.70 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |