C17H12N2O3S — CID 7379013
[4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl] thiocyanate (PubChem CID 7379013) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is [4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 7379013 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [4-[[(3S)-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)[C@@H]2Cc3ccccc3C(=O)O2)cc1 |
| InChI | InChI=1S/C17H12N2O3S/c18-10-23-13-7-5-12(6-8-13)19-16(20)15-9-11-3-1-2-4-14(11)17(21)22-15/h1-8,15H,9H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | ZDORZFHAWPZBFS-HNNXBMFYSA-N |
| XLogP | 2.98 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|