C23H23NO5 — CID 5262568
cyclohexyl 4-[(1-oxo-3,4-dihydroisochromene-3-carbonyl)amino]benzoate (PubChem CID 5262568) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is cyclohexyl 4-[(1-oxo-3,4-dihydroisochromene-3-carbonyl)amino]benzoate.
| Compound Name | cyclohexyl 4-[(1-oxo-3,4-dihydroisochromene-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 5262568 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | cyclohexyl 4-[(1-oxo-3,4-dihydroisochromene-3-carbonyl)amino]benzoate |
| SMILES | O=C(OC1CCCCC1)c1ccc(NC(=O)C2Cc3ccccc3C(=O)O2)cc1 |
| InChI | InChI=1S/C23H23NO5/c25-21(20-14-16-6-4-5-9-19(16)23(27)29-20)24-17-12-10-15(11-13-17)22(26)28-18-7-2-1-3-8-18/h4-6,9-13,18,20H,1-3,7-8,14H2,(H,24,25) |
| InChIKey | SPPKENPFSGWYOJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |